C14H21NO4S2 — CID 106001705
4-(hydroxymethyl)-2-methoxy-N-(3-methylsulfanylcyclopentyl)benzenesulfonamide (PubChem CID 106001705) has the molecular formula C14H21NO4S2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 4-(hydroxymethyl)-2-methoxy-N-(3-methylsulfanylcyclopentyl)benzenesulfonamide.
| Compound Name | 4-(hydroxymethyl)-2-methoxy-N-(3-methylsulfanylcyclopentyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106001705 |
| Molecular Formula | C14H21NO4S2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 4-(hydroxymethyl)-2-methoxy-N-(3-methylsulfanylcyclopentyl)benzenesulfonamide |
| SMILES | COc1cc(CO)ccc1S(=O)(=O)NC1CCC(SC)C1 |
| InChI | InChI=1S/C14H21NO4S2/c1-19-13-7-10(9-16)3-6-14(13)21(17,18)15-11-4-5-12(8-11)20-2/h3,6-7,11-12,15-16H,4-5,8-9H2,1-2H3 |
| InChIKey | FLOGPTWGVDPSPJ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |