C13H20N2O3S2 — CID 106000954
5-(hydroxymethyl)-N-(4-methylsulfanylcyclohexyl)pyridine-2-sulfonamide (PubChem CID 106000954) has the molecular formula C13H20N2O3S2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 5-(hydroxymethyl)-N-(4-methylsulfanylcyclohexyl)pyridine-2-sulfonamide.
| Compound Name | 5-(hydroxymethyl)-N-(4-methylsulfanylcyclohexyl)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 106000954 |
| Molecular Formula | C13H20N2O3S2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 5-(hydroxymethyl)-N-(4-methylsulfanylcyclohexyl)pyridine-2-sulfonamide |
| SMILES | CSC1CCC(NS(=O)(=O)c2ccc(CO)cn2)CC1 |
| InChI | InChI=1S/C13H20N2O3S2/c1-19-12-5-3-11(4-6-12)15-20(17,18)13-7-2-10(9-16)8-14-13/h2,7-8,11-12,15-16H,3-6,9H2,1H3 |
| InChIKey | IZYHBAGUISZGLP-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |