C12H20N2O3S2 — CID 106000983
5-(hydroxymethyl)-N-(4-methylsulfanylcyclohexyl)-1H-pyrrole-3-sulfonamide (PubChem CID 106000983) has the molecular formula C12H20N2O3S2 and a molecular weight of 304.44 g/mol. Its IUPAC name is 5-(hydroxymethyl)-N-(4-methylsulfanylcyclohexyl)-1H-pyrrole-3-sulfonamide.
| Compound Name | 5-(hydroxymethyl)-N-(4-methylsulfanylcyclohexyl)-1H-pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106000983 |
| Molecular Formula | C12H20N2O3S2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 5-(hydroxymethyl)-N-(4-methylsulfanylcyclohexyl)-1H-pyrrole-3-sulfonamide |
| SMILES | CSC1CCC(NS(=O)(=O)c2c[nH]c(CO)c2)CC1 |
| InChI | InChI=1S/C12H20N2O3S2/c1-18-11-4-2-9(3-5-11)14-19(16,17)12-6-10(8-15)13-7-12/h6-7,9,11,13-15H,2-5,8H2,1H3 |
| InChIKey | KRXJZAAPOAQZDL-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |