C13H21NO4S2 — CID 106000990
5-(hydroxymethyl)-2-methyl-N-(4-methylsulfanylcyclohexyl)furan-3-sulfonamide (PubChem CID 106000990) has the molecular formula C13H21NO4S2 and a molecular weight of 319.45 g/mol. Its IUPAC name is 5-(hydroxymethyl)-2-methyl-N-(4-methylsulfanylcyclohexyl)furan-3-sulfonamide.
| Compound Name | 5-(hydroxymethyl)-2-methyl-N-(4-methylsulfanylcyclohexyl)furan-3-sulfonamide |
|---|---|
| PubChem CID | 106000990 |
| Molecular Formula | C13H21NO4S2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 5-(hydroxymethyl)-2-methyl-N-(4-methylsulfanylcyclohexyl)furan-3-sulfonamide |
| SMILES | CSC1CCC(NS(=O)(=O)c2cc(CO)oc2C)CC1 |
| InChI | InChI=1S/C13H21NO4S2/c1-9-13(7-11(8-15)18-9)20(16,17)14-10-3-5-12(19-2)6-4-10/h7,10,12,14-15H,3-6,8H2,1-2H3 |
| InChIKey | QPVGOXJIVQOFAI-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |