C12H18BrNO4S2 — CID 106001289
2-bromo-5-(hydroxymethyl)-N-(2-methylsulfanylcyclohexyl)furan-3-sulfonamide (PubChem CID 106001289) has the molecular formula C12H18BrNO4S2 and a molecular weight of 384.32 g/mol. Its IUPAC name is 2-bromo-5-(hydroxymethyl)-N-(2-methylsulfanylcyclohexyl)furan-3-sulfonamide.
| Compound Name | 2-bromo-5-(hydroxymethyl)-N-(2-methylsulfanylcyclohexyl)furan-3-sulfonamide |
|---|---|
| PubChem CID | 106001289 |
| Molecular Formula | C12H18BrNO4S2 |
| Molecular Weight | 384.32 g/mol |
| Exact Mass | 382.99 |
| IUPAC Name | 2-bromo-5-(hydroxymethyl)-N-(2-methylsulfanylcyclohexyl)furan-3-sulfonamide |
| SMILES | CSC1CCCCC1NS(=O)(=O)c1cc(CO)oc1Br |
| InChI | InChI=1S/C12H18BrNO4S2/c1-19-10-5-3-2-4-9(10)14-20(16,17)11-6-8(7-15)18-12(11)13/h6,9-10,14-15H,2-5,7H2,1H3 |
| InChIKey | NOUYIYGSHQQCRA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |