C13H19BrN2O2S2 — CID 106091659
4-(aminomethyl)-2-bromo-N-(2-methylsulfanylcyclopentyl)benzenesulfonamide (PubChem CID 106091659) has the molecular formula C13H19BrN2O2S2 and a molecular weight of 379.35 g/mol. Its IUPAC name is 4-(aminomethyl)-2-bromo-N-(2-methylsulfanylcyclopentyl)benzenesulfonamide.
| Compound Name | 4-(aminomethyl)-2-bromo-N-(2-methylsulfanylcyclopentyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106091659 |
| Molecular Formula | C13H19BrN2O2S2 |
| Molecular Weight | 379.35 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | 4-(aminomethyl)-2-bromo-N-(2-methylsulfanylcyclopentyl)benzenesulfonamide |
| SMILES | CSC1CCCC1NS(=O)(=O)c1ccc(CN)cc1Br |
| InChI | InChI=1S/C13H19BrN2O2S2/c1-19-12-4-2-3-11(12)16-20(17,18)13-6-5-9(8-15)7-10(13)14/h5-7,11-12,16H,2-4,8,15H2,1H3 |
| InChIKey | AQCACCXPJVOGJU-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |