C13H19BrN2O3S — CID 106093875
4-(aminomethyl)-2-bromo-N-(2-methyloxan-4-yl)benzenesulfonamide (PubChem CID 106093875) has the molecular formula C13H19BrN2O3S and a molecular weight of 363.28 g/mol. Its IUPAC name is 4-(aminomethyl)-2-bromo-N-(2-methyloxan-4-yl)benzenesulfonamide.
| Compound Name | 4-(aminomethyl)-2-bromo-N-(2-methyloxan-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 106093875 |
| Molecular Formula | C13H19BrN2O3S |
| Molecular Weight | 363.28 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | 4-(aminomethyl)-2-bromo-N-(2-methyloxan-4-yl)benzenesulfonamide |
| SMILES | CC1CC(NS(=O)(=O)c2ccc(CN)cc2Br)CCO1 |
| InChI | InChI=1S/C13H19BrN2O3S/c1-9-6-11(4-5-19-9)16-20(17,18)13-3-2-10(8-15)7-12(13)14/h2-3,7,9,11,16H,4-6,8,15H2,1H3 |
| InChIKey | DQDNMQYGQZPLNO-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.28 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |