C11H16BrN3O2S2 — CID 103823754
2-amino-5-bromo-N-(2-methylsulfanylcyclopentyl)pyridine-3-sulfonamide (PubChem CID 103823754) has the molecular formula C11H16BrN3O2S2 and a molecular weight of 366.31 g/mol. Its IUPAC name is 2-amino-5-bromo-N-(2-methylsulfanylcyclopentyl)pyridine-3-sulfonamide.
| Compound Name | 2-amino-5-bromo-N-(2-methylsulfanylcyclopentyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 103823754 |
| Molecular Formula | C11H16BrN3O2S2 |
| Molecular Weight | 366.31 g/mol |
| Exact Mass | 364.99 |
| IUPAC Name | 2-amino-5-bromo-N-(2-methylsulfanylcyclopentyl)pyridine-3-sulfonamide |
| SMILES | CSC1CCCC1NS(=O)(=O)c1cc(Br)cnc1N |
| InChI | InChI=1S/C11H16BrN3O2S2/c1-18-9-4-2-3-8(9)15-19(16,17)10-5-7(12)6-14-11(10)13/h5-6,8-9,15H,2-4H2,1H3,(H2,13,14) |
| InChIKey | YYXHTFMCZIQVQC-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |