C9H11BrN2O2S — CID 158819540
5-bromo-3-(cyclopropylmethylsulfonyl)pyridin-2-amine (PubChem CID 158819540) has the molecular formula C9H11BrN2O2S and a molecular weight of 291.17 g/mol. Its IUPAC name is 5-bromo-3-(cyclopropylmethylsulfonyl)pyridin-2-amine.
| Compound Name | 5-bromo-3-(cyclopropylmethylsulfonyl)pyridin-2-amine |
|---|---|
| PubChem CID | 158819540 |
| Molecular Formula | C9H11BrN2O2S |
| Molecular Weight | 291.17 g/mol |
| Exact Mass | 289.97 |
| IUPAC Name | 5-bromo-3-(cyclopropylmethylsulfonyl)pyridin-2-amine |
| SMILES | Nc1ncc(Br)cc1S(=O)(=O)CC1CC1 |
| InChI | InChI=1S/C9H11BrN2O2S/c10-7-3-8(9(11)12-4-7)15(13,14)5-6-1-2-6/h3-4,6H,1-2,5H2,(H2,11,12) |
| InChIKey | VLAGLWKWRRLVRE-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.17 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |