C12H18BrN3O2S — CID 104968716
5-bromo-3-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonylpyridin-2-amine (PubChem CID 104968716) has the molecular formula C12H18BrN3O2S and a molecular weight of 348.27 g/mol. Its IUPAC name is 5-bromo-3-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonylpyridin-2-amine.
| Compound Name | 5-bromo-3-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 104968716 |
| Molecular Formula | C12H18BrN3O2S |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | 5-bromo-3-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonylpyridin-2-amine |
| SMILES | C[C@@H]1CCC[C@H](C)N1S(=O)(=O)c1cc(Br)cnc1N |
| InChI | InChI=1S/C12H18BrN3O2S/c1-8-4-3-5-9(2)16(8)19(17,18)11-6-10(13)7-15-12(11)14/h6-9H,3-5H2,1-2H3,(H2,14,15)/t8-,9+ |
| InChIKey | OWQGNJILFFSFGW-DTORHVGOSA-N |
| XLogP | 2.38 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |