C11H16BrNO2S3 — CID 103748807
5-bromo-2-methyl-N-(2-methylsulfanylcyclopentyl)thiophene-3-sulfonamide (PubChem CID 103748807) has the molecular formula C11H16BrNO2S3 and a molecular weight of 370.36 g/mol. Its IUPAC name is 5-bromo-2-methyl-N-(2-methylsulfanylcyclopentyl)thiophene-3-sulfonamide.
| Compound Name | 5-bromo-2-methyl-N-(2-methylsulfanylcyclopentyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 103748807 |
| Molecular Formula | C11H16BrNO2S3 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 368.95 |
| IUPAC Name | 5-bromo-2-methyl-N-(2-methylsulfanylcyclopentyl)thiophene-3-sulfonamide |
| SMILES | CSC1CCCC1NS(=O)(=O)c1cc(Br)sc1C |
| InChI | InChI=1S/C11H16BrNO2S3/c1-7-10(6-11(12)17-7)18(14,15)13-8-4-3-5-9(8)16-2/h6,8-9,13H,3-5H2,1-2H3 |
| InChIKey | QEUVEAAIFJTOLY-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |