C9H12Br2N2O2S2 — CID 63251942
N-(2-aminocyclopentyl)-2,5-dibromothiophene-3-sulfonamide (PubChem CID 63251942) has the molecular formula C9H12Br2N2O2S2 and a molecular weight of 404.15 g/mol. Its IUPAC name is N-(2-aminocyclopentyl)-2,5-dibromothiophene-3-sulfonamide.
| Compound Name | N-(2-aminocyclopentyl)-2,5-dibromothiophene-3-sulfonamide |
|---|---|
| PubChem CID | 63251942 |
| Molecular Formula | C9H12Br2N2O2S2 |
| Molecular Weight | 404.15 g/mol |
| Exact Mass | 401.87 |
| IUPAC Name | N-(2-aminocyclopentyl)-2,5-dibromothiophene-3-sulfonamide |
| SMILES | NC1CCCC1NS(=O)(=O)c1cc(Br)sc1Br |
| InChI | InChI=1S/C9H12Br2N2O2S2/c10-8-4-7(9(11)16-8)17(14,15)13-6-3-1-2-5(6)12/h4-6,13H,1-3,12H2 |
| InChIKey | UYBWXAFQFJZFNC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.15 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |