C13H17BrN2O4S — CID 61404616
3-[(2-aminocyclohexyl)sulfamoyl]-4-bromobenzoic acid (PubChem CID 61404616) has the molecular formula C13H17BrN2O4S and a molecular weight of 377.26 g/mol. Its IUPAC name is 3-[(2-aminocyclohexyl)sulfamoyl]-4-bromobenzoic acid.
| Compound Name | 3-[(2-aminocyclohexyl)sulfamoyl]-4-bromobenzoic acid |
|---|---|
| PubChem CID | 61404616 |
| Molecular Formula | C13H17BrN2O4S |
| Molecular Weight | 377.26 g/mol |
| Exact Mass | 376.01 |
| IUPAC Name | 3-[(2-aminocyclohexyl)sulfamoyl]-4-bromobenzoic acid |
| SMILES | NC1CCCCC1NS(=O)(=O)c1cc(C(=O)O)ccc1Br |
| InChI | InChI=1S/C13H17BrN2O4S/c14-9-6-5-8(13(17)18)7-12(9)21(19,20)16-11-4-2-1-3-10(11)15/h5-7,10-11,16H,1-4,15H2,(H,17,18) |
| InChIKey | DAUIVWMIMQLQPX-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |