C13H21BrN2O3S — CID 106002889
5-(aminomethyl)-2-bromo-N-(2-ethylcyclohexyl)furan-3-sulfonamide (PubChem CID 106002889) has the molecular formula C13H21BrN2O3S and a molecular weight of 365.29 g/mol. Its IUPAC name is 5-(aminomethyl)-2-bromo-N-(2-ethylcyclohexyl)furan-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-2-bromo-N-(2-ethylcyclohexyl)furan-3-sulfonamide |
|---|---|
| PubChem CID | 106002889 |
| Molecular Formula | C13H21BrN2O3S |
| Molecular Weight | 365.29 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 5-(aminomethyl)-2-bromo-N-(2-ethylcyclohexyl)furan-3-sulfonamide |
| SMILES | CCC1CCCCC1NS(=O)(=O)c1cc(CN)oc1Br |
| InChI | InChI=1S/C13H21BrN2O3S/c1-2-9-5-3-4-6-11(9)16-20(17,18)12-7-10(8-15)19-13(12)14/h7,9,11,16H,2-6,8,15H2,1H3 |
| InChIKey | DETBRGNGTWJJJU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |