C7H12BrN3O3S — CID 106074764
5-(aminomethyl)-2-bromo-N',N'-dimethylfuran-3-sulfonohydrazide (PubChem CID 106074764) has the molecular formula C7H12BrN3O3S and a molecular weight of 298.16 g/mol. Its IUPAC name is 5-(aminomethyl)-2-bromo-N',N'-dimethylfuran-3-sulfonohydrazide.
| Compound Name | 5-(aminomethyl)-2-bromo-N',N'-dimethylfuran-3-sulfonohydrazide |
|---|---|
| PubChem CID | 106074764 |
| Molecular Formula | C7H12BrN3O3S |
| Molecular Weight | 298.16 g/mol |
| Exact Mass | 296.98 |
| IUPAC Name | 5-(aminomethyl)-2-bromo-N',N'-dimethylfuran-3-sulfonohydrazide |
| SMILES | CN(C)NS(=O)(=O)c1cc(CN)oc1Br |
| InChI | InChI=1S/C7H12BrN3O3S/c1-11(2)10-15(12,13)6-3-5(4-9)14-7(6)8/h3,10H,4,9H2,1-2H3 |
| InChIKey | ZRSGEGIQDBVUJN-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 88.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.16 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|