C12H22BrN3O3S — CID 106052222
5-(aminomethyl)-2-bromo-N-[1-(diethylamino)propan-2-yl]furan-3-sulfonamide (PubChem CID 106052222) has the molecular formula C12H22BrN3O3S and a molecular weight of 368.30 g/mol. Its IUPAC name is 5-(aminomethyl)-2-bromo-N-[1-(diethylamino)propan-2-yl]furan-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-2-bromo-N-[1-(diethylamino)propan-2-yl]furan-3-sulfonamide |
|---|---|
| PubChem CID | 106052222 |
| Molecular Formula | C12H22BrN3O3S |
| Molecular Weight | 368.30 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | 5-(aminomethyl)-2-bromo-N-[1-(diethylamino)propan-2-yl]furan-3-sulfonamide |
| SMILES | CCN(CC)CC(C)NS(=O)(=O)c1cc(CN)oc1Br |
| InChI | InChI=1S/C12H22BrN3O3S/c1-4-16(5-2)8-9(3)15-20(17,18)11-6-10(7-14)19-12(11)13/h6,9,15H,4-5,7-8,14H2,1-3H3 |
| InChIKey | IDBYMEBYVUQBKX-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 88.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.30 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |