C13H23BrN2O3S — CID 106066783
2-bromo-5-(methylaminomethyl)-N-(4-methylhexan-2-yl)furan-3-sulfonamide (PubChem CID 106066783) has the molecular formula C13H23BrN2O3S and a molecular weight of 367.31 g/mol. Its IUPAC name is 2-bromo-5-(methylaminomethyl)-N-(4-methylhexan-2-yl)furan-3-sulfonamide.
| Compound Name | 2-bromo-5-(methylaminomethyl)-N-(4-methylhexan-2-yl)furan-3-sulfonamide |
|---|---|
| PubChem CID | 106066783 |
| Molecular Formula | C13H23BrN2O3S |
| Molecular Weight | 367.31 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 2-bromo-5-(methylaminomethyl)-N-(4-methylhexan-2-yl)furan-3-sulfonamide |
| SMILES | CCC(C)CC(C)NS(=O)(=O)c1cc(CNC)oc1Br |
| InChI | InChI=1S/C13H23BrN2O3S/c1-5-9(2)6-10(3)16-20(17,18)12-7-11(8-15-4)19-13(12)14/h7,9-10,15-16H,5-6,8H2,1-4H3 |
| InChIKey | OFLUEPHZLMSTPH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |