C14H25BrN2O3S — CID 106055502
2-bromo-N-hexan-3-yl-5-[(propan-2-ylamino)methyl]furan-3-sulfonamide (PubChem CID 106055502) has the molecular formula C14H25BrN2O3S and a molecular weight of 381.34 g/mol. Its IUPAC name is 2-bromo-N-hexan-3-yl-5-[(propan-2-ylamino)methyl]furan-3-sulfonamide.
| Compound Name | 2-bromo-N-hexan-3-yl-5-[(propan-2-ylamino)methyl]furan-3-sulfonamide |
|---|---|
| PubChem CID | 106055502 |
| Molecular Formula | C14H25BrN2O3S |
| Molecular Weight | 381.34 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 2-bromo-N-hexan-3-yl-5-[(propan-2-ylamino)methyl]furan-3-sulfonamide |
| SMILES | CCCC(CC)NS(=O)(=O)c1cc(CNC(C)C)oc1Br |
| InChI | InChI=1S/C14H25BrN2O3S/c1-5-7-11(6-2)17-21(18,19)13-8-12(20-14(13)15)9-16-10(3)4/h8,10-11,16-17H,5-7,9H2,1-4H3 |
| InChIKey | OBDPMAVUGQDNKR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |