C11H19BrN2O3S2 — CID 106063842
2-bromo-N-(2-methylsulfanylethyl)-5-[(propan-2-ylamino)methyl]furan-3-sulfonamide (PubChem CID 106063842) has the molecular formula C11H19BrN2O3S2 and a molecular weight of 371.32 g/mol. Its IUPAC name is 2-bromo-N-(2-methylsulfanylethyl)-5-[(propan-2-ylamino)methyl]furan-3-sulfonamide.
| Compound Name | 2-bromo-N-(2-methylsulfanylethyl)-5-[(propan-2-ylamino)methyl]furan-3-sulfonamide |
|---|---|
| PubChem CID | 106063842 |
| Molecular Formula | C11H19BrN2O3S2 |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 370.00 |
| IUPAC Name | 2-bromo-N-(2-methylsulfanylethyl)-5-[(propan-2-ylamino)methyl]furan-3-sulfonamide |
| SMILES | CSCCNS(=O)(=O)c1cc(CNC(C)C)oc1Br |
| InChI | InChI=1S/C11H19BrN2O3S2/c1-8(2)13-7-9-6-10(11(12)17-9)19(15,16)14-4-5-18-3/h6,8,13-14H,4-5,7H2,1-3H3 |
| InChIKey | PAUQDIHOLHJZNB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|