C13H20Cl2N2O2S2 — CID 106063814
2,4-dichloro-N-(2-methylsulfanylethyl)-3-[(propan-2-ylamino)methyl]benzenesulfonamide (PubChem CID 106063814) has the molecular formula C13H20Cl2N2O2S2 and a molecular weight of 371.36 g/mol. Its IUPAC name is 2,4-dichloro-N-(2-methylsulfanylethyl)-3-[(propan-2-ylamino)methyl]benzenesulfonamide.
| Compound Name | 2,4-dichloro-N-(2-methylsulfanylethyl)-3-[(propan-2-ylamino)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106063814 |
| Molecular Formula | C13H20Cl2N2O2S2 |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | 2,4-dichloro-N-(2-methylsulfanylethyl)-3-[(propan-2-ylamino)methyl]benzenesulfonamide |
| SMILES | CSCCNS(=O)(=O)c1ccc(Cl)c(CNC(C)C)c1Cl |
| InChI | InChI=1S/C13H20Cl2N2O2S2/c1-9(2)16-8-10-11(14)4-5-12(13(10)15)21(18,19)17-6-7-20-3/h4-5,9,16-17H,6-8H2,1-3H3 |
| InChIKey | PIHQBHJISUKIDU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|