C13H20Cl2N2O3S — CID 106085335
3-(aminomethyl)-2,4-dichloro-N-[2-(2-methylpropoxy)ethyl]benzenesulfonamide (PubChem CID 106085335) has the molecular formula C13H20Cl2N2O3S and a molecular weight of 355.29 g/mol. Its IUPAC name is 3-(aminomethyl)-2,4-dichloro-N-[2-(2-methylpropoxy)ethyl]benzenesulfonamide.
| Compound Name | 3-(aminomethyl)-2,4-dichloro-N-[2-(2-methylpropoxy)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106085335 |
| Molecular Formula | C13H20Cl2N2O3S |
| Molecular Weight | 355.29 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 3-(aminomethyl)-2,4-dichloro-N-[2-(2-methylpropoxy)ethyl]benzenesulfonamide |
| SMILES | CC(C)COCCNS(=O)(=O)c1ccc(Cl)c(CN)c1Cl |
| InChI | InChI=1S/C13H20Cl2N2O3S/c1-9(2)8-20-6-5-17-21(18,19)12-4-3-11(14)10(7-16)13(12)15/h3-4,9,17H,5-8,16H2,1-2H3 |
| InChIKey | NXQPCXKVLIVMHD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|