C12H18Cl2N2O3S — CID 106077482
3-(aminomethyl)-2,4-dichloro-N-(2-propan-2-yloxyethyl)benzenesulfonamide (PubChem CID 106077482) has the molecular formula C12H18Cl2N2O3S and a molecular weight of 341.26 g/mol. Its IUPAC name is 3-(aminomethyl)-2,4-dichloro-N-(2-propan-2-yloxyethyl)benzenesulfonamide.
| Compound Name | 3-(aminomethyl)-2,4-dichloro-N-(2-propan-2-yloxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106077482 |
| Molecular Formula | C12H18Cl2N2O3S |
| Molecular Weight | 341.26 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 3-(aminomethyl)-2,4-dichloro-N-(2-propan-2-yloxyethyl)benzenesulfonamide |
| SMILES | CC(C)OCCNS(=O)(=O)c1ccc(Cl)c(CN)c1Cl |
| InChI | InChI=1S/C12H18Cl2N2O3S/c1-8(2)19-6-5-16-20(17,18)11-4-3-10(13)9(7-15)12(11)14/h3-4,8,16H,5-7,15H2,1-2H3 |
| InChIKey | SYSVIBNSFQFJGB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.26 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|