C14H23ClN2O3S — CID 106016293
4-(aminomethyl)-2-chloro-N-(4-propan-2-yloxybutyl)benzenesulfonamide (PubChem CID 106016293) has the molecular formula C14H23ClN2O3S and a molecular weight of 334.87 g/mol. Its IUPAC name is 4-(aminomethyl)-2-chloro-N-(4-propan-2-yloxybutyl)benzenesulfonamide.
| Compound Name | 4-(aminomethyl)-2-chloro-N-(4-propan-2-yloxybutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106016293 |
| Molecular Formula | C14H23ClN2O3S |
| Molecular Weight | 334.87 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 4-(aminomethyl)-2-chloro-N-(4-propan-2-yloxybutyl)benzenesulfonamide |
| SMILES | CC(C)OCCCCNS(=O)(=O)c1ccc(CN)cc1Cl |
| InChI | InChI=1S/C14H23ClN2O3S/c1-11(2)20-8-4-3-7-17-21(18,19)14-6-5-12(10-16)9-13(14)15/h5-6,9,11,17H,3-4,7-8,10,16H2,1-2H3 |
| InChIKey | YVBGUUFGDNLJEK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.87 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|