C12H18Cl2N2O2S2 — CID 106066154
2,4-dichloro-3-(methylaminomethyl)-N-(3-methylsulfanylpropyl)benzenesulfonamide (PubChem CID 106066154) has the molecular formula C12H18Cl2N2O2S2 and a molecular weight of 357.33 g/mol. Its IUPAC name is 2,4-dichloro-3-(methylaminomethyl)-N-(3-methylsulfanylpropyl)benzenesulfonamide.
| Compound Name | 2,4-dichloro-3-(methylaminomethyl)-N-(3-methylsulfanylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106066154 |
| Molecular Formula | C12H18Cl2N2O2S2 |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | 2,4-dichloro-3-(methylaminomethyl)-N-(3-methylsulfanylpropyl)benzenesulfonamide |
| SMILES | CNCc1c(Cl)ccc(S(=O)(=O)NCCCSC)c1Cl |
| InChI | InChI=1S/C12H18Cl2N2O2S2/c1-15-8-9-10(13)4-5-11(12(9)14)20(17,18)16-6-3-7-19-2/h4-5,15-16H,3,6-8H2,1-2H3 |
| InChIKey | KCVDYDONAWCPDD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|