C12H12Cl2N4O2S — CID 106071850
2,4-dichloro-3-(methylaminomethyl)-N-pyrimidin-2-ylbenzenesulfonamide (PubChem CID 106071850) has the molecular formula C12H12Cl2N4O2S and a molecular weight of 347.23 g/mol. Its IUPAC name is 2,4-dichloro-3-(methylaminomethyl)-N-pyrimidin-2-ylbenzenesulfonamide.
| Compound Name | 2,4-dichloro-3-(methylaminomethyl)-N-pyrimidin-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 106071850 |
| Molecular Formula | C12H12Cl2N4O2S |
| Molecular Weight | 347.23 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | 2,4-dichloro-3-(methylaminomethyl)-N-pyrimidin-2-ylbenzenesulfonamide |
| SMILES | CNCc1c(Cl)ccc(S(=O)(=O)Nc2ncccn2)c1Cl |
| InChI | InChI=1S/C12H12Cl2N4O2S/c1-15-7-8-9(13)3-4-10(11(8)14)21(19,20)18-12-16-5-2-6-17-12/h2-6,15H,7H2,1H3,(H,16,17,18) |
| InChIKey | PRTYGQBMDCVWCG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.23 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |