C11H19BrN2O3S — CID 106055358
5-(aminomethyl)-2-bromo-N-hexan-3-ylfuran-3-sulfonamide (PubChem CID 106055358) has the molecular formula C11H19BrN2O3S and a molecular weight of 339.26 g/mol. Its IUPAC name is 5-(aminomethyl)-2-bromo-N-hexan-3-ylfuran-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-2-bromo-N-hexan-3-ylfuran-3-sulfonamide |
|---|---|
| PubChem CID | 106055358 |
| Molecular Formula | C11H19BrN2O3S |
| Molecular Weight | 339.26 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 5-(aminomethyl)-2-bromo-N-hexan-3-ylfuran-3-sulfonamide |
| SMILES | CCCC(CC)NS(=O)(=O)c1cc(CN)oc1Br |
| InChI | InChI=1S/C11H19BrN2O3S/c1-3-5-8(4-2)14-18(15,16)10-6-9(7-13)17-11(10)12/h6,8,14H,3-5,7,13H2,1-2H3 |
| InChIKey | GCQCOZNJLLWJRL-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |