C12H21NO4S — CID 114134681
N-hexan-3-yl-5-(hydroxymethyl)-2-methylfuran-3-sulfonamide (PubChem CID 114134681) has the molecular formula C12H21NO4S and a molecular weight of 275.37 g/mol. Its IUPAC name is N-hexan-3-yl-5-(hydroxymethyl)-2-methylfuran-3-sulfonamide.
| Compound Name | N-hexan-3-yl-5-(hydroxymethyl)-2-methylfuran-3-sulfonamide |
|---|---|
| PubChem CID | 114134681 |
| Molecular Formula | C12H21NO4S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | N-hexan-3-yl-5-(hydroxymethyl)-2-methylfuran-3-sulfonamide |
| SMILES | CCCC(CC)NS(=O)(=O)c1cc(CO)oc1C |
| InChI | InChI=1S/C12H21NO4S/c1-4-6-10(5-2)13-18(15,16)12-7-11(8-14)17-9(12)3/h7,10,13-14H,4-6,8H2,1-3H3 |
| InChIKey | AFXFWIUVOODZRO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |