C10H17NO5S — CID 102701313
5-(hydroxymethyl)-N-(2-methoxypropyl)-2-methylfuran-3-sulfonamide (PubChem CID 102701313) has the molecular formula C10H17NO5S and a molecular weight of 263.31 g/mol. Its IUPAC name is 5-(hydroxymethyl)-N-(2-methoxypropyl)-2-methylfuran-3-sulfonamide.
| Compound Name | 5-(hydroxymethyl)-N-(2-methoxypropyl)-2-methylfuran-3-sulfonamide |
|---|---|
| PubChem CID | 102701313 |
| Molecular Formula | C10H17NO5S |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 5-(hydroxymethyl)-N-(2-methoxypropyl)-2-methylfuran-3-sulfonamide |
| SMILES | COC(C)CNS(=O)(=O)c1cc(CO)oc1C |
| InChI | InChI=1S/C10H17NO5S/c1-7(15-3)5-11-17(13,14)10-4-9(6-12)16-8(10)2/h4,7,11-12H,5-6H2,1-3H3 |
| InChIKey | SXYZKFPKHILXOR-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |