C9H12F3NO4S2 — CID 106433689
5-(hydroxymethyl)-2-methyl-N-[2-(trifluoromethylsulfanyl)ethyl]furan-3-sulfonamide (PubChem CID 106433689) has the molecular formula C9H12F3NO4S2 and a molecular weight of 319.33 g/mol. Its IUPAC name is 5-(hydroxymethyl)-2-methyl-N-[2-(trifluoromethylsulfanyl)ethyl]furan-3-sulfonamide.
| Compound Name | 5-(hydroxymethyl)-2-methyl-N-[2-(trifluoromethylsulfanyl)ethyl]furan-3-sulfonamide |
|---|---|
| PubChem CID | 106433689 |
| Molecular Formula | C9H12F3NO4S2 |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 5-(hydroxymethyl)-2-methyl-N-[2-(trifluoromethylsulfanyl)ethyl]furan-3-sulfonamide |
| SMILES | Cc1oc(CO)cc1S(=O)(=O)NCCSC(F)(F)F |
| InChI | InChI=1S/C9H12F3NO4S2/c1-6-8(4-7(5-14)17-6)19(15,16)13-2-3-18-9(10,11)12/h4,13-14H,2-3,5H2,1H3 |
| InChIKey | CQBLPHGEUIAVQB-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|