C10H15F3N2O3S2 — CID 106433466
5-(ethylaminomethyl)-N-[2-(trifluoromethylsulfanyl)ethyl]furan-2-sulfonamide (PubChem CID 106433466) has the molecular formula C10H15F3N2O3S2 and a molecular weight of 332.37 g/mol. Its IUPAC name is 5-(ethylaminomethyl)-N-[2-(trifluoromethylsulfanyl)ethyl]furan-2-sulfonamide.
| Compound Name | 5-(ethylaminomethyl)-N-[2-(trifluoromethylsulfanyl)ethyl]furan-2-sulfonamide |
|---|---|
| PubChem CID | 106433466 |
| Molecular Formula | C10H15F3N2O3S2 |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 5-(ethylaminomethyl)-N-[2-(trifluoromethylsulfanyl)ethyl]furan-2-sulfonamide |
| SMILES | CCNCc1ccc(S(=O)(=O)NCCSC(F)(F)F)o1 |
| InChI | InChI=1S/C10H15F3N2O3S2/c1-2-14-7-8-3-4-9(18-8)20(16,17)15-5-6-19-10(11,12)13/h3-4,14-15H,2,5-7H2,1H3 |
| InChIKey | XZCHZAIEFCYDSM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|