C11H15F3N2O3S — CID 106215501
5-(ethylaminomethyl)-N-[1-(trifluoromethyl)cyclopropyl]furan-2-sulfonamide (PubChem CID 106215501) has the molecular formula C11H15F3N2O3S and a molecular weight of 312.31 g/mol. Its IUPAC name is 5-(ethylaminomethyl)-N-[1-(trifluoromethyl)cyclopropyl]furan-2-sulfonamide.
| Compound Name | 5-(ethylaminomethyl)-N-[1-(trifluoromethyl)cyclopropyl]furan-2-sulfonamide |
|---|---|
| PubChem CID | 106215501 |
| Molecular Formula | C11H15F3N2O3S |
| Molecular Weight | 312.31 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 5-(ethylaminomethyl)-N-[1-(trifluoromethyl)cyclopropyl]furan-2-sulfonamide |
| SMILES | CCNCc1ccc(S(=O)(=O)NC2(C(F)(F)F)CC2)o1 |
| InChI | InChI=1S/C11H15F3N2O3S/c1-2-15-7-8-3-4-9(19-8)20(17,18)16-10(5-6-10)11(12,13)14/h3-4,15-16H,2,5-7H2,1H3 |
| InChIKey | LRBJUOULUKFIAG-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.31 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |