C9H11F3N2O3S — CID 114158691
5-[[[1-(trifluoromethyl)cyclopropyl]amino]methyl]furan-2-sulfonamide (PubChem CID 114158691) has the molecular formula C9H11F3N2O3S and a molecular weight of 284.26 g/mol. Its IUPAC name is 5-[[[1-(trifluoromethyl)cyclopropyl]amino]methyl]furan-2-sulfonamide.
| Compound Name | 5-[[[1-(trifluoromethyl)cyclopropyl]amino]methyl]furan-2-sulfonamide |
|---|---|
| PubChem CID | 114158691 |
| Molecular Formula | C9H11F3N2O3S |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 5-[[[1-(trifluoromethyl)cyclopropyl]amino]methyl]furan-2-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CNC2(C(F)(F)F)CC2)o1 |
| InChI | InChI=1S/C9H11F3N2O3S/c10-9(11,12)8(3-4-8)14-5-6-1-2-7(17-6)18(13,15)16/h1-2,14H,3-5H2,(H2,13,15,16) |
| InChIKey | GHAXMOOGAYMDMY-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |