C12H18F3N3O2S — CID 106218661
5-(ethylaminomethyl)-1-methyl-N-[1-(trifluoromethyl)cyclopropyl]pyrrole-3-sulfonamide (PubChem CID 106218661) has the molecular formula C12H18F3N3O2S and a molecular weight of 325.36 g/mol. Its IUPAC name is 5-(ethylaminomethyl)-1-methyl-N-[1-(trifluoromethyl)cyclopropyl]pyrrole-3-sulfonamide.
| Compound Name | 5-(ethylaminomethyl)-1-methyl-N-[1-(trifluoromethyl)cyclopropyl]pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106218661 |
| Molecular Formula | C12H18F3N3O2S |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 5-(ethylaminomethyl)-1-methyl-N-[1-(trifluoromethyl)cyclopropyl]pyrrole-3-sulfonamide |
| SMILES | CCNCc1cc(S(=O)(=O)NC2(C(F)(F)F)CC2)cn1C |
| InChI | InChI=1S/C12H18F3N3O2S/c1-3-16-7-9-6-10(8-18(9)2)21(19,20)17-11(4-5-11)12(13,14)15/h6,8,16-17H,3-5,7H2,1-2H3 |
| InChIKey | YTCMOVUHVISALI-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |