C11H16F3N3O2S — CID 106218768
1-methyl-5-(methylaminomethyl)-N-[1-(trifluoromethyl)cyclopropyl]pyrrole-3-sulfonamide (PubChem CID 106218768) has the molecular formula C11H16F3N3O2S and a molecular weight of 311.33 g/mol. Its IUPAC name is 1-methyl-5-(methylaminomethyl)-N-[1-(trifluoromethyl)cyclopropyl]pyrrole-3-sulfonamide.
| Compound Name | 1-methyl-5-(methylaminomethyl)-N-[1-(trifluoromethyl)cyclopropyl]pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106218768 |
| Molecular Formula | C11H16F3N3O2S |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 1-methyl-5-(methylaminomethyl)-N-[1-(trifluoromethyl)cyclopropyl]pyrrole-3-sulfonamide |
| SMILES | CNCc1cc(S(=O)(=O)NC2(C(F)(F)F)CC2)cn1C |
| InChI | InChI=1S/C11H16F3N3O2S/c1-15-6-8-5-9(7-17(8)2)20(18,19)16-10(3-4-10)11(12,13)14/h5,7,15-16H,3-4,6H2,1-2H3 |
| InChIKey | RPKZCFJRJJSXAD-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |