C13H25N3O2S — CID 106018909
1-methyl-5-(methylaminomethyl)-N-(2-methylpentan-3-yl)pyrrole-3-sulfonamide (PubChem CID 106018909) has the molecular formula C13H25N3O2S and a molecular weight of 287.43 g/mol. Its IUPAC name is 1-methyl-5-(methylaminomethyl)-N-(2-methylpentan-3-yl)pyrrole-3-sulfonamide.
| Compound Name | 1-methyl-5-(methylaminomethyl)-N-(2-methylpentan-3-yl)pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106018909 |
| Molecular Formula | C13H25N3O2S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 1-methyl-5-(methylaminomethyl)-N-(2-methylpentan-3-yl)pyrrole-3-sulfonamide |
| SMILES | CCC(NS(=O)(=O)c1cc(CNC)n(C)c1)C(C)C |
| InChI | InChI=1S/C13H25N3O2S/c1-6-13(10(2)3)15-19(17,18)12-7-11(8-14-4)16(5)9-12/h7,9-10,13-15H,6,8H2,1-5H3 |
| InChIKey | YPRAAQVNIIUVKL-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |