C14H18FN3O2S — CID 106070494
N-(3-fluoro-5-methylphenyl)-1-methyl-5-(methylaminomethyl)pyrrole-3-sulfonamide (PubChem CID 106070494) has the molecular formula C14H18FN3O2S and a molecular weight of 311.38 g/mol. Its IUPAC name is N-(3-fluoro-5-methylphenyl)-1-methyl-5-(methylaminomethyl)pyrrole-3-sulfonamide.
| Compound Name | N-(3-fluoro-5-methylphenyl)-1-methyl-5-(methylaminomethyl)pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106070494 |
| Molecular Formula | C14H18FN3O2S |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | N-(3-fluoro-5-methylphenyl)-1-methyl-5-(methylaminomethyl)pyrrole-3-sulfonamide |
| SMILES | CNCc1cc(S(=O)(=O)Nc2cc(C)cc(F)c2)cn1C |
| InChI | InChI=1S/C14H18FN3O2S/c1-10-4-11(15)6-12(5-10)17-21(19,20)14-7-13(8-16-2)18(3)9-14/h4-7,9,16-17H,8H2,1-3H3 |
| InChIKey | GEHIAJMFEBHKFF-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |