C12H21N3O2S — CID 113486202
1-ethyl-5-(methylaminomethyl)-N-(1-methylcyclopropyl)pyrrole-3-sulfonamide (PubChem CID 113486202) has the molecular formula C12H21N3O2S and a molecular weight of 271.39 g/mol. Its IUPAC name is 1-ethyl-5-(methylaminomethyl)-N-(1-methylcyclopropyl)pyrrole-3-sulfonamide.
| Compound Name | 1-ethyl-5-(methylaminomethyl)-N-(1-methylcyclopropyl)pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 113486202 |
| Molecular Formula | C12H21N3O2S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 1-ethyl-5-(methylaminomethyl)-N-(1-methylcyclopropyl)pyrrole-3-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)NC2(C)CC2)cc1CNC |
| InChI | InChI=1S/C12H21N3O2S/c1-4-15-9-11(7-10(15)8-13-3)18(16,17)14-12(2)5-6-12/h7,9,13-14H,4-6,8H2,1-3H3 |
| InChIKey | FHNNLCBSTDWBSP-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |