C14H18IN3O2S — CID 106029526
1-ethyl-N-(3-iodophenyl)-5-(methylaminomethyl)pyrrole-3-sulfonamide (PubChem CID 106029526) has the molecular formula C14H18IN3O2S and a molecular weight of 419.29 g/mol. Its IUPAC name is 1-ethyl-N-(3-iodophenyl)-5-(methylaminomethyl)pyrrole-3-sulfonamide.
| Compound Name | 1-ethyl-N-(3-iodophenyl)-5-(methylaminomethyl)pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106029526 |
| Molecular Formula | C14H18IN3O2S |
| Molecular Weight | 419.29 g/mol |
| Exact Mass | 419.02 |
| IUPAC Name | 1-ethyl-N-(3-iodophenyl)-5-(methylaminomethyl)pyrrole-3-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)Nc2cccc(I)c2)cc1CNC |
| InChI | InChI=1S/C14H18IN3O2S/c1-3-18-10-14(8-13(18)9-16-2)21(19,20)17-12-6-4-5-11(15)7-12/h4-8,10,16-17H,3,9H2,1-2H3 |
| InChIKey | ZKLUBESWRROBMR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|