C13H19N5O2S — CID 106089558
1-ethyl-5-(methylaminomethyl)-N-(pyridazin-3-ylmethyl)pyrrole-3-sulfonamide (PubChem CID 106089558) has the molecular formula C13H19N5O2S and a molecular weight of 309.39 g/mol. Its IUPAC name is 1-ethyl-5-(methylaminomethyl)-N-(pyridazin-3-ylmethyl)pyrrole-3-sulfonamide.
| Compound Name | 1-ethyl-5-(methylaminomethyl)-N-(pyridazin-3-ylmethyl)pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106089558 |
| Molecular Formula | C13H19N5O2S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 1-ethyl-5-(methylaminomethyl)-N-(pyridazin-3-ylmethyl)pyrrole-3-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)NCc2cccnn2)cc1CNC |
| InChI | InChI=1S/C13H19N5O2S/c1-3-18-10-13(7-12(18)9-14-2)21(19,20)16-8-11-5-4-6-15-17-11/h4-7,10,14,16H,3,8-9H2,1-2H3 |
| InChIKey | GTCOPSOOZBFTPA-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |