C13H25N3O3S — CID 106080742
1-ethyl-N-(1-methoxy-2-methylpropan-2-yl)-5-(methylaminomethyl)pyrrole-3-sulfonamide (PubChem CID 106080742) has the molecular formula C13H25N3O3S and a molecular weight of 303.43 g/mol. Its IUPAC name is 1-ethyl-N-(1-methoxy-2-methylpropan-2-yl)-5-(methylaminomethyl)pyrrole-3-sulfonamide.
| Compound Name | 1-ethyl-N-(1-methoxy-2-methylpropan-2-yl)-5-(methylaminomethyl)pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106080742 |
| Molecular Formula | C13H25N3O3S |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 1-ethyl-N-(1-methoxy-2-methylpropan-2-yl)-5-(methylaminomethyl)pyrrole-3-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)NC(C)(C)COC)cc1CNC |
| InChI | InChI=1S/C13H25N3O3S/c1-6-16-9-12(7-11(16)8-14-4)20(17,18)15-13(2,3)10-19-5/h7,9,14-15H,6,8,10H2,1-5H3 |
| InChIKey | NSNCQTHLIZTZNS-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |