C13H23N3O4S — CID 106080492
N-[(3-methoxyoxolan-3-yl)methyl]-1-methyl-5-(methylaminomethyl)pyrrole-3-sulfonamide (PubChem CID 106080492) has the molecular formula C13H23N3O4S and a molecular weight of 317.41 g/mol. Its IUPAC name is N-[(3-methoxyoxolan-3-yl)methyl]-1-methyl-5-(methylaminomethyl)pyrrole-3-sulfonamide.
| Compound Name | N-[(3-methoxyoxolan-3-yl)methyl]-1-methyl-5-(methylaminomethyl)pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106080492 |
| Molecular Formula | C13H23N3O4S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | N-[(3-methoxyoxolan-3-yl)methyl]-1-methyl-5-(methylaminomethyl)pyrrole-3-sulfonamide |
| SMILES | CNCc1cc(S(=O)(=O)NCC2(OC)CCOC2)cn1C |
| InChI | InChI=1S/C13H23N3O4S/c1-14-7-11-6-12(8-16(11)2)21(17,18)15-9-13(19-3)4-5-20-10-13/h6,8,14-15H,4-5,7,9-10H2,1-3H3 |
| InChIKey | QGFISQZKSAADBY-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |