C13H21N3O4S — CID 104765482
6-(ethylamino)-N-[(3-methoxyoxolan-3-yl)methyl]pyridine-3-sulfonamide (PubChem CID 104765482) has the molecular formula C13H21N3O4S and a molecular weight of 315.40 g/mol. Its IUPAC name is 6-(ethylamino)-N-[(3-methoxyoxolan-3-yl)methyl]pyridine-3-sulfonamide.
| Compound Name | 6-(ethylamino)-N-[(3-methoxyoxolan-3-yl)methyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 104765482 |
| Molecular Formula | C13H21N3O4S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 6-(ethylamino)-N-[(3-methoxyoxolan-3-yl)methyl]pyridine-3-sulfonamide |
| SMILES | CCNc1ccc(S(=O)(=O)NCC2(OC)CCOC2)cn1 |
| InChI | InChI=1S/C13H21N3O4S/c1-3-14-12-5-4-11(8-15-12)21(17,18)16-9-13(19-2)6-7-20-10-13/h4-5,8,16H,3,6-7,9-10H2,1-2H3,(H,14,15) |
| InChIKey | DLRXPOPPTOWXAF-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |