C13H15FN2O4S — CID 104706009
3-cyano-4-fluoro-N-[(3-methoxyoxolan-3-yl)methyl]benzenesulfonamide (PubChem CID 104706009) has the molecular formula C13H15FN2O4S and a molecular weight of 314.34 g/mol. Its IUPAC name is 3-cyano-4-fluoro-N-[(3-methoxyoxolan-3-yl)methyl]benzenesulfonamide.
| Compound Name | 3-cyano-4-fluoro-N-[(3-methoxyoxolan-3-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 104706009 |
| Molecular Formula | C13H15FN2O4S |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 3-cyano-4-fluoro-N-[(3-methoxyoxolan-3-yl)methyl]benzenesulfonamide |
| SMILES | COC1(CNS(=O)(=O)c2ccc(F)c(C#N)c2)CCOC1 |
| InChI | InChI=1S/C13H15FN2O4S/c1-19-13(4-5-20-9-13)8-16-21(17,18)11-2-3-12(14)10(6-11)7-15/h2-3,6,16H,4-5,8-9H2,1H3 |
| InChIKey | FQXYKQDYVDZTRO-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |