C13H19FN2O4S — CID 116792216
3-amino-5-fluoro-N-[(3-methoxyoxolan-3-yl)methyl]-4-methylbenzenesulfonamide (PubChem CID 116792216) has the molecular formula C13H19FN2O4S and a molecular weight of 318.37 g/mol. Its IUPAC name is 3-amino-5-fluoro-N-[(3-methoxyoxolan-3-yl)methyl]-4-methylbenzenesulfonamide.
| Compound Name | 3-amino-5-fluoro-N-[(3-methoxyoxolan-3-yl)methyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 116792216 |
| Molecular Formula | C13H19FN2O4S |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 3-amino-5-fluoro-N-[(3-methoxyoxolan-3-yl)methyl]-4-methylbenzenesulfonamide |
| SMILES | COC1(CNS(=O)(=O)c2cc(N)c(C)c(F)c2)CCOC1 |
| InChI | InChI=1S/C13H19FN2O4S/c1-9-11(14)5-10(6-12(9)15)21(17,18)16-7-13(19-2)3-4-20-8-13/h5-6,16H,3-4,7-8,15H2,1-2H3 |
| InChIKey | HHTNUSKJQYUAPK-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|