C12H22N2O4S — CID 79266874
5-(ethylaminomethyl)-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]furan-2-sulfonamide (PubChem CID 79266874) has the molecular formula C12H22N2O4S and a molecular weight of 290.39 g/mol. Its IUPAC name is 5-(ethylaminomethyl)-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]furan-2-sulfonamide.
| Compound Name | 5-(ethylaminomethyl)-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]furan-2-sulfonamide |
|---|---|
| PubChem CID | 79266874 |
| Molecular Formula | C12H22N2O4S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 5-(ethylaminomethyl)-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]furan-2-sulfonamide |
| SMILES | CCNCc1ccc(S(=O)(=O)N[C@H](CO)C(C)C)o1 |
| InChI | InChI=1S/C12H22N2O4S/c1-4-13-7-10-5-6-12(18-10)19(16,17)14-11(8-15)9(2)3/h5-6,9,11,13-15H,4,7-8H2,1-3H3/t11-/m1/s1 |
| InChIKey | OUEVVIBBTXWJHZ-LLVKDONJSA-N |
| XLogP | 0.68 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |