C12H22N2O5S — CID 106162836
5-(ethylaminomethyl)-N-(4-hydroxy-1-methoxybutan-2-yl)furan-2-sulfonamide (PubChem CID 106162836) has the molecular formula C12H22N2O5S and a molecular weight of 306.38 g/mol. Its IUPAC name is 5-(ethylaminomethyl)-N-(4-hydroxy-1-methoxybutan-2-yl)furan-2-sulfonamide.
| Compound Name | 5-(ethylaminomethyl)-N-(4-hydroxy-1-methoxybutan-2-yl)furan-2-sulfonamide |
|---|---|
| PubChem CID | 106162836 |
| Molecular Formula | C12H22N2O5S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 5-(ethylaminomethyl)-N-(4-hydroxy-1-methoxybutan-2-yl)furan-2-sulfonamide |
| SMILES | CCNCc1ccc(S(=O)(=O)NC(CCO)COC)o1 |
| InChI | InChI=1S/C12H22N2O5S/c1-3-13-8-11-4-5-12(19-11)20(16,17)14-10(6-7-15)9-18-2/h4-5,10,13-15H,3,6-9H2,1-2H3 |
| InChIKey | XPOFLHHNVYFTLV-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 100.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |