C11H16FNO4S — CID 103887495
3-fluoro-N-(4-hydroxy-1-methoxybutan-2-yl)benzenesulfonamide (PubChem CID 103887495) has the molecular formula C11H16FNO4S and a molecular weight of 277.32 g/mol. Its IUPAC name is 3-fluoro-N-(4-hydroxy-1-methoxybutan-2-yl)benzenesulfonamide.
| Compound Name | 3-fluoro-N-(4-hydroxy-1-methoxybutan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 103887495 |
| Molecular Formula | C11H16FNO4S |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 3-fluoro-N-(4-hydroxy-1-methoxybutan-2-yl)benzenesulfonamide |
| SMILES | COCC(CCO)NS(=O)(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C11H16FNO4S/c1-17-8-10(5-6-14)13-18(15,16)11-4-2-3-9(12)7-11/h2-4,7,10,13-14H,5-6,8H2,1H3 |
| InChIKey | HDMGPMFWQXFZMT-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |