C11H15FN2O6S — CID 106156998
2-fluoro-N-(4-hydroxy-1-methoxybutan-2-yl)-5-nitrobenzenesulfonamide (PubChem CID 106156998) has the molecular formula C11H15FN2O6S and a molecular weight of 322.31 g/mol. Its IUPAC name is 2-fluoro-N-(4-hydroxy-1-methoxybutan-2-yl)-5-nitrobenzenesulfonamide.
| Compound Name | 2-fluoro-N-(4-hydroxy-1-methoxybutan-2-yl)-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 106156998 |
| Molecular Formula | C11H15FN2O6S |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 2-fluoro-N-(4-hydroxy-1-methoxybutan-2-yl)-5-nitrobenzenesulfonamide |
| SMILES | COCC(CCO)NS(=O)(=O)c1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C11H15FN2O6S/c1-20-7-8(4-5-15)13-21(18,19)11-6-9(14(16)17)2-3-10(11)12/h2-3,6,8,13,15H,4-5,7H2,1H3 |
| InChIKey | OLOQXGLZMMVRBL-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|