C10H13FN2O6S — CID 106184824
4-fluoro-N-(1-hydroxy-3-methoxypropan-2-yl)-2-nitrobenzenesulfonamide (PubChem CID 106184824) has the molecular formula C10H13FN2O6S and a molecular weight of 308.29 g/mol. Its IUPAC name is 4-fluoro-N-(1-hydroxy-3-methoxypropan-2-yl)-2-nitrobenzenesulfonamide.
| Compound Name | 4-fluoro-N-(1-hydroxy-3-methoxypropan-2-yl)-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 106184824 |
| Molecular Formula | C10H13FN2O6S |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 4-fluoro-N-(1-hydroxy-3-methoxypropan-2-yl)-2-nitrobenzenesulfonamide |
| SMILES | COCC(CO)NS(=O)(=O)c1ccc(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H13FN2O6S/c1-19-6-8(5-14)12-20(17,18)10-3-2-7(11)4-9(10)13(15)16/h2-4,8,12,14H,5-6H2,1H3 |
| InChIKey | YKQBKPQYPAUUBT-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|