C10H14F2N2O4S — CID 106181976
5-amino-2,4-difluoro-N-(1-hydroxy-3-methoxypropan-2-yl)benzenesulfonamide (PubChem CID 106181976) has the molecular formula C10H14F2N2O4S and a molecular weight of 296.30 g/mol. Its IUPAC name is 5-amino-2,4-difluoro-N-(1-hydroxy-3-methoxypropan-2-yl)benzenesulfonamide.
| Compound Name | 5-amino-2,4-difluoro-N-(1-hydroxy-3-methoxypropan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 106181976 |
| Molecular Formula | C10H14F2N2O4S |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 5-amino-2,4-difluoro-N-(1-hydroxy-3-methoxypropan-2-yl)benzenesulfonamide |
| SMILES | COCC(CO)NS(=O)(=O)c1cc(N)c(F)cc1F |
| InChI | InChI=1S/C10H14F2N2O4S/c1-18-5-6(4-15)14-19(16,17)10-3-9(13)7(11)2-8(10)12/h2-3,6,14-15H,4-5,13H2,1H3 |
| InChIKey | CZUXSDNVEDMTLO-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|